3-Methoxy-4-(2-phenylethoxy)benzaldehyde

• Catalog Number: ACMA00002925
• Category: Ethers
• Molecular Weight: 256.30
• Molecular Formula: C₁₆H₁₅ClO₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The molecular formula is C16H16O3.

What is the molecular weight of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The molecular weight is 256.30 g/mol.

What is the IUPAC name of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The IUPAC name is 3-methoxy-4-(2-phenylethoxy)benzaldehyde.

What is the InChI of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The InChI is InChI=1S/C16H16O3/c1-18-16-11-14(12-17)7-8-15(16)19-10-9-13-5-3-2-4-6-13/h2-8,11-12H,9-10H2,1H3.

What is the InChIKey of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The InChIKey is LMQXMNKNBDWQMB-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The canonical SMILES is COC1=C(C=CC(=C1)C=O)OCCC2=CC=CC=C2.

What is the CAS number of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The CAS number is 149428-74-0.

What is the XLogP3-AA value of 3-Methoxy-4-(2-phenylethoxy)benzaldehyde?

The XLogP3-AA value is 3.3.

How many hydrogen bond donor counts does 3-Methoxy-4-(2-phenylethoxy)benzaldehyde have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Methoxy-4-(2-phenylethoxy)benzaldehyde have?

It has 3 hydrogen bond acceptor counts.