(2-Chloro-5-methyl-phenoxy)-acetic acid

• Catalog Number: ACMA00002924
• Category: Ethers
• Molecular Weight: 200.62
• Molecular Formula: C₉H₉BrO₃
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(2-chloro-5-methylphenoxy)acetic acid.

What is the molecular formula of the compound?

The molecular formula of the compound is C9H9ClO3.

What is the molecular weight of the compound?

The molecular weight of the compound is 200.62 g/mol.

What is the InChIKey of the compound?

The InChIKey of the compound is JEJIBWJTYHKGFO-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is CC1=CC(=C(C=C1)Cl)OCC(=O)O.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 3 rotatable bond counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 46.5Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.