CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-(3-Bromophenoxy)propanoic acid
Catalog Number
ACMA00002926
Category
Ethers
Molecular Weight
245.07
Molecular Formula
C9H9BrO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H301
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of 2-(3-Bromophenoxy)propanoic acid?
The molecular formula of 2-(3-Bromophenoxy)propanoic acid is C9H9BrO3.
What is the molecular weight of 2-(3-Bromophenoxy)propanoic acid?
The molecular weight of 2-(3-Bromophenoxy)propanoic acid is 245.07 g/mol.
What is the IUPAC name of 2-(3-Bromophenoxy)propanoic acid?
The IUPAC name of 2-(3-Bromophenoxy)propanoic acid is 2-(3-bromophenoxy)propanoic acid.
What is the InChI of 2-(3-Bromophenoxy)propanoic acid?
The InChI of 2-(3-Bromophenoxy)propanoic acid is InChI=1S/C9H9BrO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12).
What is the InChIKey of 2-(3-Bromophenoxy)propanoic acid?
The InChIKey of 2-(3-Bromophenoxy)propanoic acid is CVTUTWGZPGJAQL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(3-Bromophenoxy)propanoic acid?
The canonical SMILES of 2-(3-Bromophenoxy)propanoic acid is CC(C(=O)O)OC1=CC(=CC=C1)Br.
What is the CAS number of 2-(3-Bromophenoxy)propanoic acid?
The CAS number of 2-(3-Bromophenoxy)propanoic acid is 41183-67-9.
What is the XLogP3 value of 2-(3-Bromophenoxy)propanoic acid?
The XLogP3 value of 2-(3-Bromophenoxy)propanoic acid is 2.4.
What is the hydrogen bond donor count of 2-(3-Bromophenoxy)propanoic acid?
The hydrogen bond donor count of 2-(3-Bromophenoxy)propanoic acid is 1.
What is the hydrogen bond acceptor count of 2-(3-Bromophenoxy)propanoic acid?
The hydrogen bond acceptor count of 2-(3-Bromophenoxy)propanoic acid is 3.
Recommended Products
