Naphthol AS-D

• CAS: 135-61-5
• Catalog Number: ACM135615
• Category: Azoic Dyes
• Molecular Weight: 277.32
• Molecular Formula: C₁₈H₁₅NO₂
• Synonyms: 1-(2',3'-Hydroxynaphthoylamino)-2-methylbenzene;2-Naphtho-o-toluidide, 3-hydroxy-;3-hydroxy-n-(2-methylphenyl)-2-naphthalenecarboxamid;Acco Naf-Sol AS-D;Acco Naphthol AS-D;Acna Naphthol E;AcnaNaphtholE;Amanil Naphthol AS-D
• Density: 1.277 g/cm³

Custom Q&A

What is the molecular formula of Naphthol AS-D?

The molecular formula of Naphthol AS-D is C18H15NO2.

What is the molecular weight of Naphthol AS-D?

The molecular weight of Naphthol AS-D is 277.3 g/mol.

What is the IUPAC name of Naphthol AS-D?

The IUPAC name of Naphthol AS-D is 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide.

What is the InChI of Naphthol AS-D?

The InChI of Naphthol AS-D is InChI=1S/C18H15NO2/c1-12-6-2-5-9-16(12)19-18(21)15-10-13-7-3-4-8-14(13)11-17(15)20/h2-11,20H,1H3,(H,19,21).

What is the InChIKey of Naphthol AS-D?

The InChIKey of Naphthol AS-D is FBLAHUMENIHUGG-UHFFFAOYSA-N.

What is the canonical SMILES of Naphthol AS-D?

The canonical SMILES of Naphthol AS-D is CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O.

What is the CAS number of Naphthol AS-D?

The CAS number of Naphthol AS-D is 135-61-5.

What is the XLogP3-AA value of Naphthol AS-D?

The XLogP3-AA value of Naphthol AS-D is 4.6.

How many hydrogen bond donor counts does Naphthol AS-D have?

Naphthol AS-D has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Naphthol AS-D have?

Naphthol AS-D has 2 hydrogen bond acceptor counts.

What is the hydrogen bond donor count of Naphthol AS-D?

The hydrogen bond donor count of Naphthol AS-D is 2.

What is the hydrogen bond acceptor count of Naphthol AS-D?

The hydrogen bond acceptor count of Naphthol AS-D is 2.

How many rotatable bonds does Naphthol AS-D have?

Naphthol AS-D has 2 rotatable bonds.