CAS
874219-33-7 Purity
---
874219-33-7 Purity
---
Inquiry Basket
3-(3-Fluorophenylcarbamoyl)phenylboronic acid
CAS
874288-34-3
Catalog Number
ACM874288343-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H11BFNO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 259.04 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-[(3-fluorophenyl)carbamoyl]phenyl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H11BFNO3/c15-11-5-2-6-12(8-11)16-13(17)9-3-1-4-10(7-9)14(18)19/h1-8,18-19H,(H,16,17).
What is the InChIKey of the compound?
The InChIKey of the compound is OJAYVDZJZDGCFF-UHFFFAOYSA-N.
What is the CAS number of the compound?
The CAS number of the compound is 874288-34-3.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
