3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid

• Catalog Number: ACMA00000972
• Category: Amines
• Molecular Weight: 218.21
• Molecular Formula: C₁₁H₁₀N₂O₃
• Hazard Statements: H302-H400
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C11H10N2O3.

What is the molecular weight of the compound?

The molecular weight is 218.21 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-ethyl-4-oxophthalazine-1-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H10N2O3/c1-2-13-10(14)8-6-4-3-5-7(8)9(12-13)11(15)16/h3-6H,2H2,1H3,(H,15,16).

What is the InChIKey of the compound?

The InChIKey of the compound is FFEQVFZHBLPYNH-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 16015-48-8.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 2 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.