(3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester

• Catalog Number: ACMA00000973
• Category: Amines
• Molecular Weight: 244.19
• Molecular Formula: C₁₁H₉NS
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The molecular formula is C11H10F2O4.

What is the PubChem CID of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The PubChem CID is 91657869.

What is the IUPAC name of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The IUPAC name is ethyl 2-(3,4-difluoro-5-methoxyphenyl)-2-oxoacetate.

What is the InChI of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The InChI of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester is InChI=1S/C11H10F2O4/c1-3-17-11(15)10(14)6-4-7(12)9(13)8(5-6)16-2/h4-5H,3H2,1-2H3.

What is the InChIKey of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The InChIKey of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester is GMVDLZVVTVQSQR-UHFFFAOYSA-N.

What is the canonical SMILES of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The canonical SMILES is CCOC(=O)C(=O)C1=CC(=C(C(=C1)F)F)OC.

What is the molecular weight of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The molecular weight is 244.19 g/mol.

What is the XLogP3-AA value of (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

The XLogP3-AA value is 2.2.

How many hydrogen bond donor atoms are there in (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

There are 0 hydrogen bond donor atoms.

How many rotatable bonds are there in (3,4-Difluoro-5-methoxyphenyl)oxoacetic acid ethyl ester?

There are 5 rotatable bonds.