What is the molecular formula of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The molecular formula is C13H10BBrF2O3.
What is the molecular weight of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The molecular weight is 342.93 g/mol.
When was 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid created?
It was created on August 8, 2012.
When was 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The IUPAC name is (4-bromo-2,6-difluoro-3-phenylmethoxyphenyl)boronic acid.
What is the InChI of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The InChI is InChI=1S/C13H10BBrF2O3/c15-9-6-10(16)11(14(18)19)12(17)13(9)20-7-8-4-2-1-3-5-8/h1-6,18-19H,7H2.
What is the InChIKey of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The InChIKey is ZROLYOUHNLANTP-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The canonical SMILES is B(C1=C(C(=C(C=C1F)Br)OCC2=CC=CC=C2)F)(O)O.
What is the CAS number of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The CAS number is 1451393-14-8.
What is the molar mass of 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid?
The molar mass is 342.93 g/mol.