CAS
1451393-14-8 Purity
---
1451393-14-8 Purity
---
Inquiry Basket
4-Tert-butylphenylboronic acid
CAS
12324-71-0
Catalog Number
ACM12324710
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-tert-butylphenylboronic acid?
The molecular formula of 4-tert-butylphenylboronic acid is C10H15BO2.
What is the molecular weight of 4-tert-butylphenylboronic acid?
The molecular weight of 4-tert-butylphenylboronic acid is 178.04 g/mol.
What is the IUPAC name of 4-tert-butylphenylboronic acid?
The IUPAC name of 4-tert-butylphenylboronic acid is (4-tert-butylphenyl)boronic acid.
What is the InChI of 4-tert-butylphenylboronic acid?
The InChI of 4-tert-butylphenylboronic acid is InChI=1S/C10H15BO2/c1-10(2,3)8-4-6-9(7-5-8)11(12)13/h4-7,12-13H,1-3H3.
What is the InChIKey of 4-tert-butylphenylboronic acid?
The InChIKey of 4-tert-butylphenylboronic acid is MNJYZNVROSZZQC-UHFFFAOYSA-N.
What is the canonical SMILES of 4-tert-butylphenylboronic acid?
The canonical SMILES of 4-tert-butylphenylboronic acid is B(C1=CC=C(C=C1)C(C)(C)C)(O)O.
What is the CAS number of 4-tert-butylphenylboronic acid?
The CAS number of 4-tert-butylphenylboronic acid is 123324-71-0.
How many hydrogen bond donor counts are there in 4-tert-butylphenylboronic acid?
There are 2 hydrogen bond donor counts in 4-tert-butylphenylboronic acid.
How many hydrogen bond acceptor counts are there in 4-tert-butylphenylboronic acid?
There are 2 hydrogen bond acceptor counts in 4-tert-butylphenylboronic acid.
What is the topological polar surface area of 4-tert-butylphenylboronic acid?
The topological polar surface area of 4-tert-butylphenylboronic acid is 40.5Ų.
Recommended Products
