What is the molecular formula of 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The molecular formula is C7H4ClN3O2.
What is the molecular weight of 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The molecular weight is 197.58 g/mol.
When was 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid created and modified in PubChem?
It was created on 2012-01-24 and last modified on 2023-12-30.
What is the IUPAC name of 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The IUPAC name is 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid.
What is the Canonical SMILES representation of 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The Canonical SMILES representation is C1=C(N=C2N1C=C(N=C2)Cl)C(=O)O.
What is the XLogP3-AA value for 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The XLogP3-AA value is 1.5.
How many hydrogen bond donor counts are there in 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
There are 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 6-chloroimidazo[1,2-a]pyrazine-2-carboxylic acid?
The topological polar surface area is 67.5 Ų.
Is the compound is canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.