3-(2-Hydroxyphenyl)-2-propenal

• Catalog Number: ACMA00001536
• Category: Amino Alcohols
• Molecular Weight: 148.16
• Molecular Formula: C₁₆H₂₅NO ¡¤ HB
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The molecular formula is C9H8O2.

What is the molecular weight of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The molecular weight is 148.16 g/mol.

What are the synonyms of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The synonyms are 2-Hydroxycinnamaldehyde, 60125-23-7, 3-(2-Hydroxyphenyl)-2-propenal, 3541-42-2, and 3-(2-Hydroxyphenyl)acrylaldehyde.

What is the IUPAC name of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The IUPAC name is (E)-3-(2-hydroxyphenyl)prop-2-enal.

What is the InChI of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The InChI is InChI=1S/C9H8O2/c10-7-3-5-8-4-1-2-6-9(8)11/h1-7,11H/b5-3+.

What is the InChIKey of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The InChIKey is BSDNZCQPDVTDET-HWKANZROSA-N.

What is the canonical SMILES of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The canonical SMILES is C1=CC=C(C(=C1)C=CC=O)O.

What is the XLogP3-AA value of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The XLogP3-AA value is 1.5.

What is the hydrogen bond donor count of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of (E)-3-(2-Hydroxyphenyl)-2-propenal?

The hydrogen bond acceptor count is 2.