(1,5-Naphthyridin-3-yl)methanol

• Catalog Number: ACMA00001537
• Category: Amino Alcohols
• Molecular Weight: 160.17
• Molecular Formula: C₁₇H₁₇NO₃
• Hazard Statements: H314
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of (1,5-Naphthyridin-3-yl)methanol?

The molecular formula is C9H8N2O.

What is the molecular weight of (1,5-Naphthyridin-3-yl)methanol?

The molecular weight is 160.17 g/mol.

What is the IUPAC name of (1,5-Naphthyridin-3-yl)methanol?

The IUPAC name is 1,5-naphthyridin-3-ylmethanol.

What is the InChI of (1,5-Naphthyridin-3-yl)methanol?

The InChI is InChI=1S/C9H8N2O/c12-6-7-4-9-8(11-5-7)2-1-3-10-9/h1-5,12H,6H2.

What is the InChIKey of (1,5-Naphthyridin-3-yl)methanol?

The InChIKey is FONKMHAKOWUIOL-UHFFFAOYSA-N.

What is the canonical SMILES of (1,5-Naphthyridin-3-yl)methanol?

The canonical SMILES is C1=CC2=C(C=C(C=N2)CO)N=C1.

What is the CAS number of (1,5-Naphthyridin-3-yl)methanol?

The CAS number is 1261365-54-1.

What is the hydrogen bond donor count of (1,5-Naphthyridin-3-yl)methanol?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of (1,5-Naphthyridin-3-yl)methanol?

The hydrogen bond acceptor count is 3.

Is (1,5-Naphthyridin-3-yl)methanol a canonicalized compound?

Yes, (1,5-Naphthyridin-3-yl)methanol is canonicalized.