Benzo[1,3]dioxol-5-yl-acetyl chloride

• Catalog Number: ACMA00001535
• Category: Amino Alcohols
• Molecular Weight: 198.60
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The molecular formula of Benzo[1,3]dioxol-5-yl-acetyl chloride is C9H7ClO3.

What is the molecular weight of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The molecular weight of Benzo[1,3]dioxol-5-yl-acetyl chloride is 198.60 g/mol.

What is the IUPAC name of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The IUPAC name of Benzo[1,3]dioxol-5-yl-acetyl chloride is 2-(1,3-benzodioxol-5-yl)acetyl chloride.

What is the InChI of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The InChI of Benzo[1,3]dioxol-5-yl-acetyl chloride is InChI=1S/C9H7ClO3/c10-9(11)4-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5H2.

What is the InChIKey of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The InChIKey of Benzo[1,3]dioxol-5-yl-acetyl chloride is HGSZGCXMAJSUSC-UHFFFAOYSA-N.

What is the canonical SMILES of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The canonical SMILES of Benzo[1,3]dioxol-5-yl-acetyl chloride is C1OC2=C(O1)C=C(C=C2)CC(=O)Cl.

What is the CAS number of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The CAS number of Benzo[1,3]dioxol-5-yl-acetyl chloride is 6845-81-4.

What is the XLogP3 value of Benzo[1,3]dioxol-5-yl-acetyl chloride?

The XLogP3 value of Benzo[1,3]dioxol-5-yl-acetyl chloride is 2.4.

Is Benzo[1,3]dioxol-5-yl-acetyl chloride a canonicalized compound?

Yes, Benzo[1,3]dioxol-5-yl-acetyl chloride is a canonicalized compound.