2-Formyl-5-(trifluoromethyl)phenylboronic acid

• CAS: 1204580-94-8
• Catalog Number: ACM1204580948
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C8H6BF3O3.

What is the molecular weight of the compound?

The molecular weight is 217.94 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is [2-formyl-5-(trifluoromethyl)phenyl]boronic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C8H6BF3O3/c10-8(11,12)6-2-1-5(4-13)7(3-6)9(14)15/h1-4,14-15H.

What is the InChIKey of the compound?

The InChIKey is MUEODBDFMVYZAC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is B(C1=C(C=CC(=C1)C(F)(F)F)C=O)(O)O.

What is the CAS number of the compound?

The CAS number is 1204580-94-8.

What is the European Community (EC) number of the compound?

The European Community (EC) number is 886-534-2.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID is DTXSID30676696.

Does the compound have a defined bond stereocenter count?

No, the compound does not have a defined bond stereocenter count.