2,6-Difluoropyridine-4-boronic acid

• CAS: 401816-16-8
• Catalog Number: ACM401816168
• Category: Boronic Acids
• Molecular Weight: 158.90
• Molecular Formula: C₅H₄BF₂NO₂

Custom Q&A

What is the molecular formula of 2,6-Difluoropyridine-4-boronic acid?

The molecular formula is C5H4BF2NO2.

What is the molecular weight of 2,6-Difluoropyridine-4-boronic acid?

The molecular weight is 158.90 g/mol.

What is the IUPAC name of 2,6-Difluoropyridine-4-boronic acid?

The IUPAC name is (2,6-difluoropyridin-4-yl)boronic acid.

What is the InChI of 2,6-Difluoropyridine-4-boronic acid?

The InChI is InChI=1S/C5H4BF2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2,10-11H.

What is the InChIKey of 2,6-Difluoropyridine-4-boronic acid?

The InChIKey is KMEJCVYIVUQTSP-UHFFFAOYSA-N.

What is the canonical SMILES of 2,6-Difluoropyridine-4-boronic acid?

The canonical SMILES is B(C1=CC(=NC(=C1)F)F)(O)O.

What is the CAS number of 2,6-Difluoropyridine-4-boronic acid?

The CAS number is 401816-16-8.

What is the European Community (EC) number of 2,6-Difluoropyridine-4-boronic acid?

The European Community (EC) number is 816-376-1.

What is the DSSTox Substance ID of 2,6-Difluoropyridine-4-boronic acid?

The DSSTox Substance ID is DTXSID20376416.

Does 2,6-Difluoropyridine-4-boronic acid have defined bond and atom stereocenters?

No, it does not have defined bond or atom stereocenters.