2-Fluoropyridine-4-boronic acid

• CAS: 401815-98-3
• Catalog Number: ACM401815983
• Category: Boronic Acids
• Molecular Weight: 140.91
• Molecular Formula: C₅H₅BFNO₂
• Synonyms: 2-FLUOROPYRIDINE-4-BORONIC ACID;2-FLUOROPYRIDIN-4-YLBORONIC ACID;2-FLUORO-4-PYRIDINEBORONIC ACID;2-FLUORO-4-PYRIDINYLBORONIC ACID;Boronic acid, (2-fluoro-4-pyridinyl)- (9CI);2-Fluoro-4-pyridinylboronic acid ,97%;2-fluoropyridin-4-yl-4-boronic acid;4-Boron

Custom Q&A

What is the molecular formula of 2-Fluoropyridine-4-boronic acid?

The molecular formula of 2-Fluoropyridine-4-boronic acid is C5H5BFNO2.

What is the molecular weight of 2-Fluoropyridine-4-boronic acid?

The molecular weight of 2-Fluoropyridine-4-boronic acid is 140.91 g/mol.

What is the IUPAC name of 2-Fluoropyridine-4-boronic acid?

The IUPAC name of 2-Fluoropyridine-4-boronic acid is (2-fluoropyridin-4-yl)boronic acid.

What is the InChI of 2-Fluoropyridine-4-boronic acid?

The InChI of 2-Fluoropyridine-4-boronic acid is InChI=1S/C5H5BFNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3,9-10H.

What is the InChIKey of 2-Fluoropyridine-4-boronic acid?

The InChIKey of 2-Fluoropyridine-4-boronic acid is WXGBZJJAGLSBPR-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Fluoropyridine-4-boronic acid?

The canonical SMILES of 2-Fluoropyridine-4-boronic acid is B(C1=CC(=NC=C1)F)(O)O.

What is the CAS number of 2-Fluoropyridine-4-boronic acid?

The CAS number of 2-Fluoropyridine-4-boronic acid is 401815-98-3.

What is the EC number of 2-Fluoropyridine-4-boronic acid?

The EC number of 2-Fluoropyridine-4-boronic acid is 640-138-4.

What is the ChEMBL ID of 2-Fluoropyridine-4-boronic acid?

The ChEMBL ID of 2-Fluoropyridine-4-boronic acid is CHEMBL3236586.

Is 2-Fluoropyridine-4-boronic acid a canonicalized compound?

Yes, 2-Fluoropyridine-4-boronic acid is a canonicalized compound.