CAS
214360-69-7 Purity
98
214360-69-7 Purity
98
Inquiry Basket
2-Formyl-4-methoxyphenylboronic acid pinacol ester
CAS
1132669-90-9
Catalog Number
ACM1132669909
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The molecular formula of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is C14H19BO4.
What is the molecular weight of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The molecular weight of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is 262.11 g/mol.
What is the IUPAC name of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The IUPAC name of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
What is the InChI of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The InChI of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is InChI=1S/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)12-7-6-11(17-5)8-10(12)9-16/h6-9H,1-5H3.
What is the InChIKey of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The InChIKey of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is JRAWTSMQMAUECH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The canonical SMILES of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)C=O.
What is the hydrogen bond donor count of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The hydrogen bond donor count of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is 0.
What is the hydrogen bond acceptor count of 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
The hydrogen bond acceptor count of 2-Formyl-4-methoxyphenylboronic acid pinacol ester is 4.
How many rotatable bonds are in 2-Formyl-4-methoxyphenylboronic acid pinacol ester?
There are 3 rotatable bonds in 2-Formyl-4-methoxyphenylboronic acid pinacol ester.
Is 2-Formyl-4-methoxyphenylboronic acid pinacol ester a canonicalized compound?
Yes, 2-Formyl-4-methoxyphenylboronic acid pinacol ester is a canonicalized compound.
Upstream Synthesis Route 1
- 98015-07-7
- 1132669-90-9
Reference: [1]Lautens, Mark; Marquardt, Tzvetelina
[Journal of Organic Chemistry, 2004, vol. 69, # 14, p. 4607 - 4614]
Recommended Products
CAS
219489-09-5 Purity
96%
219489-09-5 Purity
96%
