2-Nitrobenzeneboronic acid pinacol ester

• CAS: 190788-59-1
• Catalog Number: ACM190788591
• Category: Boronic Esters

Custom Q&A

What is the PubChem CID for 2-Nitrobenzeneboronic acid pinacol ester?

The PubChem CID for 2-Nitrobenzeneboronic acid pinacol ester is 3699568.

What is the molecular formula of 2-Nitrobenzeneboronic acid pinacol ester?

The molecular formula of 2-Nitrobenzeneboronic acid pinacol ester is C12H16BNO4.

What is the molecular weight of 2-Nitrobenzeneboronic acid pinacol ester?

The molecular weight of 2-Nitrobenzeneboronic acid pinacol ester is 249.07 g/mol.

What is the IUPAC name of 2-Nitrobenzeneboronic acid pinacol ester?

The IUPAC name of 2-Nitrobenzeneboronic acid pinacol ester is 4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane.

What is the InChI of 2-Nitrobenzeneboronic acid pinacol ester?

The InChI of 2-Nitrobenzeneboronic acid pinacol ester is InChI=1S/C12H16BNO4/c1-11(2)12(3,4)18-13(17-11)9-7-5-6-8-10(9)14(15)16/h5-8H,1-4H3.

What is the InChIKey of 2-Nitrobenzeneboronic acid pinacol ester?

The InChIKey of 2-Nitrobenzeneboronic acid pinacol ester is VLJYUDGCEKORNG-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Nitrobenzeneboronic acid pinacol ester?

The canonical SMILES of 2-Nitrobenzeneboronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2[N+](=O)[O-].

What is the CAS number for 2-Nitrobenzeneboronic acid pinacol ester?

The CAS number for 2-Nitrobenzeneboronic acid pinacol ester is 190788-59-1.

What is the European Community (EC) Number for 2-Nitrobenzeneboronic acid pinacol ester?

The European Community (EC) Number for 2-Nitrobenzeneboronic acid pinacol ester is 681-615-7.

Is 2-Nitrobenzeneboronic acid pinacol ester a canonicalized compound?

Yes, 2-Nitrobenzeneboronic acid pinacol ester is a canonicalized compound.