Thiophene-3-boronic acid pinacol ester

• CAS: 214360-70-0
• Catalog Number: ACM214360700
• Category: Boronic Esters
• Molecular Weight: 210.1
• Molecular Formula: C₁₀H₁₅BO₂S

Custom Q&A

What is the molecular formula of thiophene-3-boronic acid pinacol ester?

The molecular formula is C10H15BO2S.

What is the molecular weight of thiophene-3-boronic acid pinacol ester?

The molecular weight is 210.11 g/mol.

What is the IUPAC name of thiophene-3-boronic acid pinacol ester?

The IUPAC name is 4,4,5,5-tetramethyl-2-thiophen-3-yl-1,3,2-dioxaborolane.

What is the InChI of thiophene-3-boronic acid pinacol ester?

The InChI is InChI=1S/C10H15BO2S/c1-9(2)10(3,4)13-11(12-9)8-5-6-14-7-8/h5-7H,1-4H3.

What is the InChIKey of thiophene-3-boronic acid pinacol ester?

The InChIKey is HQXQOBAEDQBINI-UHFFFAOYSA-N.

What is the canonical SMILES of thiophene-3-boronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CSC=C2.

What is the CAS number of thiophene-3-boronic acid pinacol ester?

The CAS number is 214360-70-0.

What is the EC number of thiophene-3-boronic acid pinacol ester?

The EC number is 674-923-8.

What is the DSSTox Substance ID of thiophene-3-boronic acid pinacol ester?

The DSSTox Substance ID is DTXSID10375251.

Is the compound canonicalized?

Yes, the compound is canonicalized.