2-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid

• CAS: 874289-43-7
• Catalog Number: ACM874289437-1
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C12H15BFNO3.

What are the synonyms of the compound?

The synonyms are 874289-43-7, (2-Fluoro-5-(piperidine-1-carbonyl)phenyl)boronic acid, 2-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid, and more.

What is the molecular weight of the compound?

The molecular weight is 251.06 g/mol.

When was the compound created?

The compound was created on March 14, 2010.

What is the IUPAC name of the compound?

The IUPAC name is [2-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid.

What is the InChI of the compound?

The InChI is "InChI=1S/C12H15BFNO3/c14-11-5-4-9(8-10(11)13(17)18)12(16)15-6-2-1-3-7-15/h4-5,8,17-18H,1-3,6-7H2".

What is the InChIKey of the compound?

The InChIKey is "PBARTZZYZFNCJU-UHFFFAOYSA-N".

What is the canonical SMILES of the compound?

The canonical SMILES is "B(C1=C(C=CC(=C1)C(=O)N2CCCCC2)F)(O)O".

What is the CAS number of the compound?

The CAS number is 874289-43-7.

Is the compound canonicalized?

Yes, the compound is canonicalized.