2-Chloro-6-fluoro-5-hydroxyphenylboronic acid

• CAS: 958646-67-8
• Catalog Number: ACM958646678
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The molecular formula of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is C6H5BClFO3.

What is the molecular weight of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The molecular weight of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is 190.37 g/mol.

When was 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid created?

2-Chloro-6-fluoro-5-hydroxyphenylboronic acid was created on August 8, 2012.

What is the IUPAC name of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The IUPAC name of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is (6-chloro-2-fluoro-3-hydroxyphenyl)boronic acid.

What is the InChI of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The InChI of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is InChI=1S/C6H5BClFO3/c8-3-1-2-4(10)6(9)5(3)7(11)12/h1-2,10-12H.

What is the InChIKey of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The InChIKey of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is VHBSCHINLGAFRL-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid?

The canonical SMILES of 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid is B(C1=C(C=CC(=C1F)O)Cl)(O)O.

How many hydrogen bond donor counts does 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid have?

2-Chloro-6-fluoro-5-hydroxyphenylboronic acid has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid have?

2-Chloro-6-fluoro-5-hydroxyphenylboronic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid have?

2-Chloro-6-fluoro-5-hydroxyphenylboronic acid has 1 rotatable bond count.