2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid

• CAS: 874289-49-3
• Catalog Number: ACM874289493-1
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The molecular formula is C10H13BFNO3.

When was 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid created and modified?

It was created on 2010-03-14 and modified on 2023-12-02.

What is the IUPAC name of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The IUPAC name is [2-fluoro-5-(propan-2-ylcarbamoyl)phenyl]boronic acid.

What is the InChIKey of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The InChIKey is NCRUGKRIPMSQHI-UHFFFAOYSA-N.

What is the Canonical SMILES representation of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The Canonical SMILES is B(C1=C(C=CC(=C1)C(=O)NC(C)C)F)(O)O.

What is the CAS number for 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The CAS number is 874289-49-3.

What is the molecular weight of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The molecular weight is 225.03 g/mol.

How many hydrogen bond donor counts are there in 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

There are 3 hydrogen bond donor counts.

What is the exact mass of 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid?

The exact mass is 225.0972516 g/mol.

Is 2-Fluoro-5-(isopropylcarbamoyl)phenylboronic acid a canonicalized compound according to PubChem?

Yes, it is a canonicalized compound.