CAS
874219-60-0 Purity
---
874219-60-0 Purity
---
Shopping basket
2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid
CAS
874289-26-6
Catalog Number
ACM874289266
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The molecular formula is C12H15BFNO3.
What is the PubChem CID of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The PubChem CID is 53417044.
What is the IUPAC name of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The IUPAC name is [2-fluoro-4-(piperidine-1-carbonyl)phenyl]boronic acid.
What is the InChI of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The InChI is InChI=1S/C12H15BFNO3/c14-11-8-9(4-5-10(11)13(17)18)12(16)15-6-2-1-3-7-15/h4-5,8,17-18H,1-3,6-7H2.
What is the InChIKey of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The InChIKey is AEPOPOPNJZJRMQ-UHFFFAOYSA-N.
What is the CAS number of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The CAS number is 874289-26-6.
What is the molecular weight of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The molecular weight is 251.06 g/mol.
How many hydrogen bond donor count does 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid have?
It has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid have?
It has 4 hydrogen bond acceptor count.
What is the topological polar surface area of 2-Fluoro-4-(piperidine-1-carbonyl)phenylboronic acid?
The topological polar surface area is 60.8Ų.
Recommended Products
