CAS
1451393-49-9 Purity
---
1451393-49-9 Purity
---
Shopping basket
2-Fluoro-3-carboxypyridine-5-boronic acid
CAS
1451393-51-3
Catalog Number
ACM1451393513
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The molecular formula is C6H5BFNO4.
What is the molecular weight of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The molecular weight is 184.92 g/mol.
What is the IUPAC name of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The IUPAC name is 5-borono-2-fluoropyridine-3-carboxylic acid.
What is the InChI of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The InChI is InChI=1S/C6H5BFNO4/c8-5-4(6(10)11)1-3(2-9-5)7(12)13/h1-2,12-13H,(H,10,11).
What is the InChIKey of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The InChIKey is NINXDEFTKZXEEA-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The canonical SMILES is B(C1=CC(=C(N=C1)F)C(=O)O)(O)O.
How many hydrogen bond donor counts does 2-Fluoro-3-carboxypyridine-5-boronic acid have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Fluoro-3-carboxypyridine-5-boronic acid have?
It has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Fluoro-3-carboxypyridine-5-boronic acid?
The topological polar surface area is 90.6Ų.
How many heavy atoms are present in 2-Fluoro-3-carboxypyridine-5-boronic acid?
There are 13 heavy atoms.
Recommended Products
