CAS
1451393-50-2 Purity
---
1451393-50-2 Purity
---
Inquiry Basket
5-Bromo-2-chloropyridine-4-boronic acid
CAS
871329-63-4
Catalog Number
ACM871329634-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-chloropyridine-4-boronic acid?
The molecular formula of 5-Bromo-2-chloropyridine-4-boronic acid is C5H4BBrClNO2.
What is the molecular weight of 5-Bromo-2-chloropyridine-4-boronic acid?
The molecular weight of 5-Bromo-2-chloropyridine-4-boronic acid is 236.26 g/mol.
When was 5-Bromo-2-chloropyridine-4-boronic acid created?
5-Bromo-2-chloropyridine-4-boronic acid was created on March 23, 2010.
What is the IUPAC name of 5-Bromo-2-chloropyridine-4-boronic acid?
The IUPAC name of 5-Bromo-2-chloropyridine-4-boronic acid is (5-bromo-2-chloropyridin-4-yl)boronic acid.
What is the InChI of 5-Bromo-2-chloropyridine-4-boronic acid?
The InChI of 5-Bromo-2-chloropyridine-4-boronic acid is InChI=1S/C5H4BBrClNO2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2,10-11H.
What is the InChIKey of 5-Bromo-2-chloropyridine-4-boronic acid?
The InChIKey of 5-Bromo-2-chloropyridine-4-boronic acid is MGZZMCLHPCQEIN-UHFFFAOYSA-N.
What is the canonical SMILES representation of 5-Bromo-2-chloropyridine-4-boronic acid?
The canonical SMILES representation of 5-Bromo-2-chloropyridine-4-boronic acid is B(C1=CC(=NC=C1Br)Cl)(O)O.
What other identifiers are associated with 5-Bromo-2-chloropyridine-4-boronic acid?
The CAS identifier for 5-Bromo-2-chloropyridine-4-boronic acid is 871329-63-4 and the DSSTox Substance ID is DTXSID50661206.
What is the hydrogen bond donor count of 5-Bromo-2-chloropyridine-4-boronic acid?
The hydrogen bond donor count of 5-Bromo-2-chloropyridine-4-boronic acid is 2.
Is 5-Bromo-2-chloropyridine-4-boronic acid considered as a canonicalized compound?
Yes, 5-Bromo-2-chloropyridine-4-boronic acid is considered as a canonicalized compound.
Recommended Products
