2-Chloro-4-hydroxyphenylboronic acid

• CAS: 766549-26-2
• Catalog Number: ACM766549262
• Category: Boronic Acids
• Molecular Weight: 172.37
• Molecular Formula: C₆H₆BClO₃

Custom Q&A

What is the molecular formula of 2-Chloro-4-hydroxyphenylboronic acid?

The molecular formula of 2-Chloro-4-hydroxyphenylboronic acid is C6H6BClO3.

What is the molecular weight of 2-Chloro-4-hydroxyphenylboronic acid?

The molecular weight of 2-Chloro-4-hydroxyphenylboronic acid is 172.37 g/mol.

What is the IUPAC name of 2-Chloro-4-hydroxyphenylboronic acid?

The IUPAC name of 2-Chloro-4-hydroxyphenylboronic acid is (2-chloro-4-hydroxyphenyl)boronic acid.

What is the InChI of 2-Chloro-4-hydroxyphenylboronic acid?

The InChI of 2-Chloro-4-hydroxyphenylboronic acid is InChI=1S/C6H6BClO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9-11H.

What is the InChIKey of 2-Chloro-4-hydroxyphenylboronic acid?

The InChIKey of 2-Chloro-4-hydroxyphenylboronic acid is NRBQMBXPVAUMJY-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Chloro-4-hydroxyphenylboronic acid?

The canonical SMILES of 2-Chloro-4-hydroxyphenylboronic acid is B(C1=C(C=C(C=C1)O)Cl)(O)O.

What is the CAS number of 2-Chloro-4-hydroxyphenylboronic acid?

The CAS number of 2-Chloro-4-hydroxyphenylboronic acid is 766549-26-2.

What is the hydrogen bond donor count of 2-Chloro-4-hydroxyphenylboronic acid?

The hydrogen bond donor count of 2-Chloro-4-hydroxyphenylboronic acid is 3.

What is the hydrogen bond acceptor count of 2-Chloro-4-hydroxyphenylboronic acid?

The hydrogen bond acceptor count of 2-Chloro-4-hydroxyphenylboronic acid is 3.

Is 2-Chloro-4-hydroxyphenylboronic acid a canonicalized compound?

Yes, 2-Chloro-4-hydroxyphenylboronic acid is a canonicalized compound.