CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Chloro-5-trifluoromethylbenzyl chloride
Catalog Number
ACMA00000662
Category
Alkyl
Molecular Weight
229.03
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Chloro-5-trifluoromethylbenzyl chloride?
The molecular formula of 2-Chloro-5-trifluoromethylbenzyl chloride is C8H5Cl2F3.
What is the molecular weight of 2-Chloro-5-trifluoromethylbenzyl chloride?
The molecular weight of 2-Chloro-5-trifluoromethylbenzyl chloride is 229.02 g/mol.
What is the IUPAC name of 2-Chloro-5-trifluoromethylbenzyl chloride?
The IUPAC name of 2-Chloro-5-trifluoromethylbenzyl chloride is 1-chloro-2-(chloromethyl)-4-(trifluoromethyl)benzene.
What is the InChI of 2-Chloro-5-trifluoromethylbenzyl chloride?
The InChI of 2-Chloro-5-trifluoromethylbenzyl chloride is InChI=1S/C8H5Cl2F3/c9-4-5-3-6(8(11,12)13)1-2-7(5)10/h1-3H,4H2.
What is the InChIKey of 2-Chloro-5-trifluoromethylbenzyl chloride?
The InChIKey of 2-Chloro-5-trifluoromethylbenzyl chloride is HIWZQKSEJHGZAZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-5-trifluoromethylbenzyl chloride?
The canonical SMILES of 2-Chloro-5-trifluoromethylbenzyl chloride is C1=CC(=C(C=C1C(F)(F)F)CCl)Cl.
What is the CAS number of 2-Chloro-5-trifluoromethylbenzyl chloride?
The CAS number of 2-Chloro-5-trifluoromethylbenzyl chloride is 22902-87-0.
What is the EC number of 2-Chloro-5-trifluoromethylbenzyl chloride?
The EC number of 2-Chloro-5-trifluoromethylbenzyl chloride is 675-116-3.
What is the XLogP3-AA value of 2-Chloro-5-trifluoromethylbenzyl chloride?
The XLogP3-AA value of 2-Chloro-5-trifluoromethylbenzyl chloride is 3.8.
Is 2-Chloro-5-trifluoromethylbenzyl chloride a canonicalized compound?
Yes, 2-Chloro-5-trifluoromethylbenzyl chloride is a canonicalized compound.
Recommended Products
