2,3-Difluoro-4-methylbenzyl bromide

• Catalog Number: ACMA00000661
• Category: Alkyl
• Molecular Weight: 221.04
• Molecular Formula: C₈H₅BrF₄
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,3-Difluoro-4-methylbenzyl bromide?

The molecular formula is C8H7BrF2.

What is the molecular weight of 2,3-Difluoro-4-methylbenzyl bromide?

The molecular weight is 221.04 g/mol.

What is the IUPAC name of 2,3-Difluoro-4-methylbenzyl bromide?

The IUPAC name is 1-(bromomethyl)-2,3-difluoro-4-methylbenzene.

What is the InChI of 2,3-Difluoro-4-methylbenzyl bromide?

The InChI is InChI=1S/C8H7BrF2/c1-5-2-3-6(4-9)8(11)7(5)10/h2-3H,4H2,1H3.

What is the InChIKey of 2,3-Difluoro-4-methylbenzyl bromide?

The InChIKey is YAPOYZMZHWXAOX-UHFFFAOYSA-N.

What is the CAS number of 2,3-Difluoro-4-methylbenzyl bromide?

The CAS number is 261763-43-3.

What is the European Community (EC) Number of 2,3-Difluoro-4-methylbenzyl bromide?

The EC Number is 670-740-2.

What is the DSSTox Substance ID of 2,3-Difluoro-4-methylbenzyl bromide?

The DSSTox Substance ID is DTXSID40378912.

What is the XLogP3-AA value of 2,3-Difluoro-4-methylbenzyl bromide?

The XLogP3-AA value is 3.

Is 2,3-Difluoro-4-methylbenzyl bromide a canonicalized compound?

Yes, it is a canonicalized compound.