What is the molecular formula of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The molecular formula is C8H5BrF4.
What is the molecular weight of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The molecular weight is 257.02 g/mol.
What is the IUPAC name of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The IUPAC name is 2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene.
What is the InChI of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The InChI is InChI=1S/C8H5BrF4/c9-4-5-3-6(8(11,12)13)1-2-7(5)10/h1-3H,4H2.
What is the InChIKey of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The InChIKey is BYRMZRWUEAESEZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The canonical SMILES is C1=CC(=C(C=C1C(F)(F)F)CBr)F.
What is the CAS number of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The CAS number is 220239-69-0.
What is the European Community (EC) number of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The European Community (EC) number is 671-098-6.
What is the DSSTox Substance ID of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The DSSTox Substance ID is DTXSID40372152.
What is the XLogP3-AA value of 2-Fluoro-5-(trifluoromethyl)benzyl bromide?
The XLogP3-AA value is 3.5.