2-Bromo-5-fluoro-4-methylaniline

• CAS: 202865-78-9
• Catalog Number: ACM202865789
• Category: Bromine Series
• Molecular Weight: 204.04
• Molecular Formula: C₇H₇BrFN

Custom Q&A

What is the molecular formula of 2-Bromo-5-fluoro-4-methylaniline?

The molecular formula of 2-Bromo-5-fluoro-4-methylaniline is C7H7BrFN.

What is the molecular weight of 2-Bromo-5-fluoro-4-methylaniline?

The molecular weight of 2-Bromo-5-fluoro-4-methylaniline is 204.04 g/mol.

What is the IUPAC name of 2-Bromo-5-fluoro-4-methylaniline?

The IUPAC name of 2-Bromo-5-fluoro-4-methylaniline is 2-bromo-5-fluoro-4-methylaniline.

What is the InChI of 2-Bromo-5-fluoro-4-methylaniline?

The InChI of 2-Bromo-5-fluoro-4-methylaniline is InChI=1S/C7H7BrFN/c1-4-2-5(8)7(10)3-6(4)9/h2-3H,10H2,1H3.

What is the InChIKey of 2-Bromo-5-fluoro-4-methylaniline?

The InChIKey of 2-Bromo-5-fluoro-4-methylaniline is ZHSUEJWJGKIOGI-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-5-fluoro-4-methylaniline?

The canonical SMILES of 2-Bromo-5-fluoro-4-methylaniline is CC1=CC(=C(C=C1F)N)Br.

What is the CAS number of 2-Bromo-5-fluoro-4-methylaniline?

The CAS number of 2-Bromo-5-fluoro-4-methylaniline is 202865-78-9.

What is the EC number of 2-Bromo-5-fluoro-4-methylaniline?

The EC number of 2-Bromo-5-fluoro-4-methylaniline is 672-497-8.

What is the ChEMBL ID of 2-Bromo-5-fluoro-4-methylaniline?

The ChEMBL ID of 2-Bromo-5-fluoro-4-methylaniline is CHEMBL4935197.

Is 2-Bromo-5-fluoro-4-methylaniline a canonicalized compound?

Yes, 2-Bromo-5-fluoro-4-methylaniline is a canonicalized compound.