2,4-Dibromo-6-fluoroanisole

• CAS: 202982-75-0
• Catalog Number: ACM202982750
• Category: Bromine Series
• Molecular Weight: 283.92
• Molecular Formula: C₇H₅Br₂FO
• Synonyms: 2,4-DIBROMO-6-FLUOROANISOLE

Custom Q&A

What is the molecular formula of 2,4-Dibromo-6-fluoroanisole?

The molecular formula of 2,4-Dibromo-6-fluoroanisole is C7H5Br2FO.

What is the molecular weight of 2,4-Dibromo-6-fluoroanisole?

The molecular weight of 2,4-Dibromo-6-fluoroanisole is 283.92 g/mol.

When was 2,4-Dibromo-6-fluoroanisole created and last modified?

2,4-Dibromo-6-fluoroanisole was created on July 19, 2005, and last modified on December 2, 2023.

What is the IUPAC name of 2,4-Dibromo-6-fluoroanisole?

The IUPAC name of 2,4-Dibromo-6-fluoroanisole is 1,5-dibromo-3-fluoro-2-methoxybenzene.

What is the InChI of 2,4-Dibromo-6-fluoroanisole?

The InChI of 2,4-Dibromo-6-fluoroanisole is InChI=1S/C7H5Br2FO/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3.

What is the InChIKey of 2,4-Dibromo-6-fluoroanisole?

The InChIKey of 2,4-Dibromo-6-fluoroanisole is AUZLPBBXLAWQLN-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-Dibromo-6-fluoroanisole?

The canonical SMILES of 2,4-Dibromo-6-fluoroanisole is COC1=C(C=C(C=C1Br)Br)F.

What is the CAS number of 2,4-Dibromo-6-fluoroanisole?

The CAS number of 2,4-Dibromo-6-fluoroanisole is 202982-75-0.

What is the XLogP3-AA value of 2,4-Dibromo-6-fluoroanisole?

The XLogP3-AA value of 2,4-Dibromo-6-fluoroanisole is 3.4.

What is the hydrogen bond acceptor count of 2,4-Dibromo-6-fluoroanisole?

The hydrogen bond acceptor count of 2,4-Dibromo-6-fluoroanisole is 2.