CAS
202865-60-9 Purity
98%
202865-60-9 Purity
98%
Inquiry Basket
5-Bromo-2-fluorocinnamic acid
CAS
202865-71-2
Catalog Number
ACM202865712
Category
Bromine Series
Molecular Weight
245.04
Molecular Formula
C9H6BrFO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-fluorocinnamic acid?
The molecular formula of 5-Bromo-2-fluorocinnamic acid is C9H6BrFO2.
What is the molecular weight of 5-Bromo-2-fluorocinnamic acid?
The molecular weight of 5-Bromo-2-fluorocinnamic acid is 245.04 g/mol.
What is the IUPAC name of 5-Bromo-2-fluorocinnamic acid?
The IUPAC name of 5-Bromo-2-fluorocinnamic acid is (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoic acid.
What is the InChI of 5-Bromo-2-fluorocinnamic acid?
The InChI of 5-Bromo-2-fluorocinnamic acid is InChI=1S/C9H6BrFO2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h1-5H,(H,12,13)/b4-1+.
What is the InChIKey of 5-Bromo-2-fluorocinnamic acid?
The InChIKey of 5-Bromo-2-fluorocinnamic acid is ROTBALNVXDGIQY-DAFODLJHSA-N.
What is the canonical SMILES of 5-Bromo-2-fluorocinnamic acid?
The canonical SMILES of 5-Bromo-2-fluorocinnamic acid is C1=CC(=C(C=C1Br)C=CC(=O)O)F.
What is the molecular weight of 5-Bromo-2-fluorocinnamic acid calculated by PubChem?
The molecular weight of 5-Bromo-2-fluorocinnamic acid is 245.04 g/mol, computed by PubChem 2.1.
How many hydrogen bond donor counts does 5-Bromo-2-fluorocinnamic acid have?
5-Bromo-2-fluorocinnamic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Bromo-2-fluorocinnamic acid have?
5-Bromo-2-fluorocinnamic acid has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 5-Bromo-2-fluorocinnamic acid?
The topological polar surface area of 5-Bromo-2-fluorocinnamic acid is 37.3Ų.
Recommended Products
