2-Benzyloxy-5-fluorophenylboronic acid

• CAS: 779331-47-4
• Catalog Number: ACM779331474
• Category: Boronic Acids
• Molecular Weight: 246.04
• Molecular Formula: C₁₃H₁₂BFO₃

Custom Q&A

What is the molecular formula of 2-Benzyloxy-5-fluorophenylboronic acid?

The molecular formula is C13H12BFO3.

What is the molecular weight of 2-Benzyloxy-5-fluorophenylboronic acid?

The molecular weight is 246.04 g/mol.

What is the IUPAC name of 2-Benzyloxy-5-fluorophenylboronic acid?

The IUPAC name is (5-fluoro-2-phenylmethoxyphenyl)boronic acid.

What is the InChI of 2-Benzyloxy-5-fluorophenylboronic acid?

The InChI is InChI=1S/C13H12BFO3/c15-11-6-7-13(12(8-11)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2.

What is the InChIKey of 2-Benzyloxy-5-fluorophenylboronic acid?

The InChIKey is ULIJNMCAPASXHA-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Benzyloxy-5-fluorophenylboronic acid?

The canonical SMILES is B(C1=C(C=CC(=C1)F)OCC2=CC=CC=C2)(O)O.

What is the CAS number of 2-Benzyloxy-5-fluorophenylboronic acid?

The CAS number is 779331-47-4.

What is the EC number of 2-Benzyloxy-5-fluorophenylboronic acid?

The EC number is 676-857-5.

What is the DSSTox Substance ID of 2-Benzyloxy-5-fluorophenylboronic acid?

The DSSTox Substance ID is DTXSID60382197.

Is 2-Benzyloxy-5-fluorophenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.