CAS
1629585-65-4 Purity
---
1629585-65-4 Purity
---
Inquiry Basket
3,5-Dichloro-4-methoxyphenylboronic acid
CAS
175883-61-1
Catalog Number
ACM175883611-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Dichloro-4-methoxyphenylboronic acid?
The molecular formula of 3,5-Dichloro-4-methoxyphenylboronic acid is C7H7BCl2O3.
What is the molecular weight of 3,5-Dichloro-4-methoxyphenylboronic acid?
The molecular weight of 3,5-Dichloro-4-methoxyphenylboronic acid is 220.84 g/mol.
What is the IUPAC name of 3,5-Dichloro-4-methoxyphenylboronic acid?
The IUPAC name of 3,5-Dichloro-4-methoxyphenylboronic acid is (3,5-dichloro-4-methoxyphenyl)boronic acid.
What is the InChI of 3,5-Dichloro-4-methoxyphenylboronic acid?
The InChI of 3,5-Dichloro-4-methoxyphenylboronic acid is InChI=1S/C7H7BCl2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3,11-12H,1H3.
What is the InChIKey of 3,5-Dichloro-4-methoxyphenylboronic acid?
The InChIKey of 3,5-Dichloro-4-methoxyphenylboronic acid is JHCLSOGJYUVJNQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dichloro-4-methoxyphenylboronic acid?
The canonical SMILES of 3,5-Dichloro-4-methoxyphenylboronic acid is B(C1=CC(=C(C(=C1)Cl)OC)Cl)(O)O.
What is the CAS number of 3,5-Dichloro-4-methoxyphenylboronic acid?
The CAS number of 3,5-Dichloro-4-methoxyphenylboronic acid is 175883-61-1.
What is the hydrogen bond donor count of 3,5-Dichloro-4-methoxyphenylboronic acid?
The hydrogen bond donor count of 3,5-Dichloro-4-methoxyphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 3,5-Dichloro-4-methoxyphenylboronic acid?
The hydrogen bond acceptor count of 3,5-Dichloro-4-methoxyphenylboronic acid is 3.
What is the topological polar surface area of 3,5-Dichloro-4-methoxyphenylboronic acid?
The topological polar surface area of 3,5-Dichloro-4-methoxyphenylboronic acid is 49.7Ų.
Recommended Products
