What is the molecular formula of 2-Methoxy-3-methylpyridine-5-boronic acid?
The molecular formula is C7H10BNO3.
What is the molecular weight of 2-Methoxy-3-methylpyridine-5-boronic acid?
The molecular weight is 166.97 g/mol.
What is the IUPAC name of 2-Methoxy-3-methylpyridine-5-boronic acid?
The IUPAC name is (6-methoxy-5-methylpyridin-3-yl)boronic acid.
What is the InChI code of 2-Methoxy-3-methylpyridine-5-boronic acid?
The InChI code is InChI=1S/C7H10BNO3/c1-5-3-6(8(10)11)4-9-7(5)12-2/h3-4,10-11H,1-2H3.
What is the InChIKey of 2-Methoxy-3-methylpyridine-5-boronic acid?
The InChIKey is QXCAEPGEVCYRJO-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Methoxy-3-methylpyridine-5-boronic acid?
The Canonical SMILES is B(C1=CC(=C(N=C1)OC)C)(O)O.
What is the CAS number of 2-Methoxy-3-methylpyridine-5-boronic acid?
The CAS number is 1083168-99-3.
What is the EPA DSSTox Substance ID of 2-Methoxy-3-methylpyridine-5-boronic acid?
The EPA DSSTox Substance ID is DTXSID60679933.
What is the Wikidata ID of 2-Methoxy-3-methylpyridine-5-boronic acid?
The Wikidata ID is Q82603407.
Is 2-Methoxy-3-methylpyridine-5-boronic acid a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.