2-Amino-5,6-dichlorobenzoic acid

• Catalog Number: ACMA00001512
• Category: Amines
• Molecular Weight: 206.03
• Molecular Formula: C₇H₅ClF₃N
• Hazard Statements: H314
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 2-Amino-5,6-dichlorobenzoic acid?

The molecular formula of 2-Amino-5,6-dichlorobenzoic acid is C7H5Cl2NO2.

What is the molecular weight of 2-Amino-5,6-dichlorobenzoic acid?

The molecular weight of 2-Amino-5,6-dichlorobenzoic acid is 206.02 g/mol.

What is the IUPAC Name of 2-Amino-5,6-dichlorobenzoic acid?

The IUPAC Name of 2-Amino-5,6-dichlorobenzoic acid is 6-amino-2,3-dichlorobenzoic acid.

What is the InChI of 2-Amino-5,6-dichlorobenzoic acid?

The InChI of 2-Amino-5,6-dichlorobenzoic acid is InChI=1S/C7H5Cl2NO2/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2H,10H2,(H,11,12).

What is the Canonical SMILES of 2-Amino-5,6-dichlorobenzoic acid?

The Canonical SMILES of 2-Amino-5,6-dichlorobenzoic acid is C1=CC(=C(C(=C1N)C(=O)O)Cl)Cl.

What is the CAS number of 2-Amino-5,6-dichlorobenzoic acid?

The CAS number of 2-Amino-5,6-dichlorobenzoic acid is 20776-60-7.

What is the XLogP3 value of 2-Amino-5,6-dichlorobenzoic acid?

The XLogP3 value of 2-Amino-5,6-dichlorobenzoic acid is 3.1.

How many hydrogen bond donor counts does 2-Amino-5,6-dichlorobenzoic acid have?

2-Amino-5,6-dichlorobenzoic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Amino-5,6-dichlorobenzoic acid have?

2-Amino-5,6-dichlorobenzoic acid has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 2-Amino-5,6-dichlorobenzoic acid?

The topological polar surface area of 2-Amino-5,6-dichlorobenzoic acid is 63.3Ų.