CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Amino-4,6-dichlorobenzoic acid
Catalog Number
ACMA00001510
Category
Amines
Molecular Weight
206.03
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H301-H317
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of 2-Amino-4,6-dichlorobenzoic acid?
The molecular formula of 2-Amino-4,6-dichlorobenzoic acid is C7H5Cl2NO2.
What is the molecular weight of 2-Amino-4,6-dichlorobenzoic acid?
The molecular weight of 2-Amino-4,6-dichlorobenzoic acid is 206.02 g/mol.
What is the IUPAC name of 2-Amino-4,6-dichlorobenzoic acid?
The IUPAC name of 2-Amino-4,6-dichlorobenzoic acid is 2-amino-4,6-dichlorobenzoic acid.
What is the InChI code of 2-Amino-4,6-dichlorobenzoic acid?
The InChI code of 2-Amino-4,6-dichlorobenzoic acid is InChI=1S/C7H5Cl2NO2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,10H2,(H,11,12).
What is the InChIKey of 2-Amino-4,6-dichlorobenzoic acid?
The InChIKey of 2-Amino-4,6-dichlorobenzoic acid is VNOYJBSEORILIE-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Amino-4,6-dichlorobenzoic acid?
The Canonical SMILES of 2-Amino-4,6-dichlorobenzoic acid is C1=C(C=C(C(=C1N)C(=O)O)Cl)Cl.
What is the CAS number of 2-Amino-4,6-dichlorobenzoic acid?
The CAS number of 2-Amino-4,6-dichlorobenzoic acid is 20776-63-0.
What is the XLogP3-AA value of 2-Amino-4,6-dichlorobenzoic acid?
The XLogP3-AA value of 2-Amino-4,6-dichlorobenzoic acid is 2.6.
How many hydrogen bond donor counts does 2-Amino-4,6-dichlorobenzoic acid have?
2-Amino-4,6-dichlorobenzoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino-4,6-dichlorobenzoic acid have?
2-Amino-4,6-dichlorobenzoic acid has 3 hydrogen bond acceptor counts.
Recommended Products
