CAS
1451391-51-7 Purity
---
1451391-51-7 Purity
---
Inquiry Basket
2,6-Dichloro-4-fluorophenylboronic acid
CAS
1451392-99-6
Catalog Number
ACM1451392996
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the official PubChem CID for 2,6-Dichloro-4-fluorophenylboronic acid?
The official PubChem CID for 2,6-Dichloro-4-fluorophenylboronic acid is 57497247.
What is the molecular formula of 2,6-Dichloro-4-fluorophenylboronic acid?
The molecular formula of 2,6-Dichloro-4-fluorophenylboronic acid is C6H4BCl2FO2.
What is the molecular weight of 2,6-Dichloro-4-fluorophenylboronic acid?
The molecular weight of 2,6-Dichloro-4-fluorophenylboronic acid is 208.81 g/mol.
What is the IUPAC name of 2,6-Dichloro-4-fluorophenylboronic acid?
The IUPAC name of 2,6-Dichloro-4-fluorophenylboronic acid is (2,6-dichloro-4-fluorophenyl)boronic acid.
What is the InChI of 2,6-Dichloro-4-fluorophenylboronic acid?
The InChI of 2,6-Dichloro-4-fluorophenylboronic acid is InChI=1S/C6H4BCl2FO2/c8-4-1-3(10)2-5(9)6(4)7(11)12/h1-2,11-12H.
What is the InChIKey of 2,6-Dichloro-4-fluorophenylboronic acid?
The InChIKey of 2,6-Dichloro-4-fluorophenylboronic acid is KXQQDVRYPXXJCR-UHFFFAOYSA-N.
What is the CAS number of 2,6-Dichloro-4-fluorophenylboronic acid?
The CAS number of 2,6-Dichloro-4-fluorophenylboronic acid is 1451392-99-6.
What is the European Community (EC) number of 2,6-Dichloro-4-fluorophenylboronic acid?
The European Community (EC) number of 2,6-Dichloro-4-fluorophenylboronic acid is 820-883-3.
What is the hydrogen bond donor count of 2,6-Dichloro-4-fluorophenylboronic acid?
The hydrogen bond donor count of 2,6-Dichloro-4-fluorophenylboronic acid is 2.
What is the topological polar surface area of 2,6-Dichloro-4-fluorophenylboronic acid?
The topological polar surface area of 2,6-Dichloro-4-fluorophenylboronic acid is 40.5Ų.
Recommended Products
CAS
1301198-10-6 Purity
---
1301198-10-6 Purity
---
CAS
1309980-72-0 Purity
---
1309980-72-0 Purity
---
