CAS
1451391-49-3 Purity
---
1451391-49-3 Purity
---
Inquiry Basket
2-Bromo-3-chloro-6-fluorophenylboronic acid
CAS
1451392-82-7
Catalog Number
ACM1451392827
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The molecular formula of 2-Bromo-3-chloro-6-fluorophenylboronic acid is C6H4BBrClFO2.
What is the molecular weight of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The molecular weight of 2-Bromo-3-chloro-6-fluorophenylboronic acid is 253.26 g/mol.
When was 2-Bromo-3-chloro-6-fluorophenylboronic acid created?
2-Bromo-3-chloro-6-fluorophenylboronic acid was created on August 8, 2012.
What is the IUPAC name of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The IUPAC name of 2-Bromo-3-chloro-6-fluorophenylboronic acid is (2-bromo-3-chloro-6-fluorophenyl)boronic acid.
What is the InChI of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The InChI of 2-Bromo-3-chloro-6-fluorophenylboronic acid is InChI=1S/C6H4BBrClFO2/c8-6-3(9)1-2-4(10)5(6)7(11)12/h1-2,11-12H.
What is the InChIKey of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The InChIKey of 2-Bromo-3-chloro-6-fluorophenylboronic acid is VXFAFMUNENKHDY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The canonical SMILES of 2-Bromo-3-chloro-6-fluorophenylboronic acid is B(C1=C(C=CC(=C1Br)Cl)F)(O)O.
How many hydrogen bond donor counts does 2-Bromo-3-chloro-6-fluorophenylboronic acid have?
2-Bromo-3-chloro-6-fluorophenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-3-chloro-6-fluorophenylboronic acid have?
2-Bromo-3-chloro-6-fluorophenylboronic acid has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Bromo-3-chloro-6-fluorophenylboronic acid?
The topological polar surface area of 2-Bromo-3-chloro-6-fluorophenylboronic acid is 40.5Ų.
Recommended Products
CAS
1301198-10-6 Purity
---
1301198-10-6 Purity
---
CAS
1309980-72-0 Purity
---
1309980-72-0 Purity
---
