2,6-Dichloro-4-methylphenylboronic acid

• CAS: 1451391-51-7
• Catalog Number: ACM1451391517
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2,6-Dichloro-4-methylphenylboronic acid?

The molecular formula of 2,6-Dichloro-4-methylphenylboronic acid is C7H7BCl2O2.

What is the molecular weight of 2,6-Dichloro-4-methylphenylboronic acid?

The molecular weight of 2,6-Dichloro-4-methylphenylboronic acid is 204.85 g/mol.

What is the IUPAC name of 2,6-Dichloro-4-methylphenylboronic acid?

The IUPAC name of 2,6-Dichloro-4-methylphenylboronic acid is (2,6-dichloro-4-methylphenyl)boronic acid.

What is the InChI of 2,6-Dichloro-4-methylphenylboronic acid?

The InChI of 2,6-Dichloro-4-methylphenylboronic acid is InChI=1S/C7H7BCl2O2/c1-4-2-5(9)7(8(11)12)6(10)3-4/h2-3,11-12H,1H3.

What is the InChIKey of 2,6-Dichloro-4-methylphenylboronic acid?

The InChIKey of 2,6-Dichloro-4-methylphenylboronic acid is ZNIJWHBCKYZTFC-UHFFFAOYSA-N.

What is the canonical SMILES of 2,6-Dichloro-4-methylphenylboronic acid?

The canonical SMILES of 2,6-Dichloro-4-methylphenylboronic acid is B(C1=C(C=C(C=C1Cl)C)Cl)(O)O.

What is the CAS number of 2,6-Dichloro-4-methylphenylboronic acid?

The CAS number of 2,6-Dichloro-4-methylphenylboronic acid is 1451391-51-7.

How many hydrogen bond donor counts does 2,6-Dichloro-4-methylphenylboronic acid have?

2,6-Dichloro-4-methylphenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2,6-Dichloro-4-methylphenylboronic acid have?

2,6-Dichloro-4-methylphenylboronic acid has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 2,6-Dichloro-4-methylphenylboronic acid have?

2,6-Dichloro-4-methylphenylboronic acid has 1 rotatable bond count.