2,5-Difluoro-4-nitrophenol

• Catalog Number: ACMA00001607
• Category: Aryl
• Molecular Weight: 175.09
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the PubChem CID of 2,5-Difluoro-4-nitrophenol?

PubChem CID: 2782490

What is the molecular formula of 2,5-Difluoro-4-nitrophenol?

Molecular Formula: C6H3F2NO3

What is the molecular weight of 2,5-Difluoro-4-nitrophenol?

Molecular Weight: 175.09 g/mol

What is the IUPAC name of 2,5-Difluoro-4-nitrophenol?

IUPAC Name: 2,5-difluoro-4-nitrophenol

What is the InChI of 2,5-Difluoro-4-nitrophenol?

InChI: InChI=1S/C6H3F2NO3/c7-3-2-6(10)4(8)1-5(3)9(11)12/h1-2,10H

What is the InChIKey of 2,5-Difluoro-4-nitrophenol?

InChIKey: WOQWWNJQZLYLMC-UHFFFAOYSA-N

What is the canonical SMILES of 2,5-Difluoro-4-nitrophenol?

Canonical SMILES: C1=C(C(=CC(=C1F)O)F)[N+](=O)[O-]

What is the CAS number of 2,5-Difluoro-4-nitrophenol?

CAS Number: 120103-18-6

What is the EC number of 2,5-Difluoro-4-nitrophenol?

EC Number: 687-943-7

Is 2,5-Difluoro-4-nitrophenol a canonicalized compound?

Compound Is Canonicalized: Yes