2,4-Difluoro-5-nitrobenzenol

• Catalog Number: ACMA00001605
• Category: Aryl
• Molecular Weight: 175.09
• Molecular Formula: C₆H₃Cl₃
• Hazard Statements: H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,4-Difluoro-5-nitrobenzenol?

The molecular formula is C6H3F2NO3.

What is the molecular weight of 2,4-Difluoro-5-nitrobenzenol?

The molecular weight is 175.09 g/mol.

What is the IUPAC name of 2,4-Difluoro-5-nitrobenzenol?

The IUPAC name is 2,4-difluoro-5-nitrophenol.

What is the InChI representation of 2,4-Difluoro-5-nitrobenzenol?

The InChI is InChI=1S/C6H3F2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H.

What is the InChIKey of 2,4-Difluoro-5-nitrobenzenol?

The InChIKey is SMRYCTJAGPDVEH-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2,4-Difluoro-5-nitrobenzenol?

The canonical SMILES is C1=C(C(=CC(=C1O)F)F)[N+](=O)[O-].

What is the CAS number of 2,4-Difluoro-5-nitrobenzenol?

The CAS number is 113512-57-5.

What is the European Community (EC) number of 2,4-Difluoro-5-nitrobenzenol?

The EC number is 642-816-5.

What is the hydrogen bond donor count of 2,4-Difluoro-5-nitrobenzenol?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 2,4-Difluoro-5-nitrobenzenol?

The hydrogen bond acceptor count is 5.