CAS
12324-71-0 Purity
---
12324-71-0 Purity
---
Inquiry Basket
2,5-Difluoro-4-hydroxyphenylboronic acid
CAS
1229584-22-8
Catalog Number
ACM1229584228
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The molecular formula is C6H5BF2O3.
What is the molecular weight of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The molecular weight is 173.91 g/mol.
What is the IUPAC name of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The IUPAC name is (2,5-difluoro-4-hydroxyphenyl)boronic acid.
What is the InChI of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The InChI is InChI=1S/C6H5BF2O3/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,10-12H.
What is the InChIKey of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The InChIKey is BKSUWYUPEDFFDX-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1F)O)F)(O)O.
What is the CAS number of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The CAS number is 1229584-22-8.
What is the European Community (EC) number of 2,5-Difluoro-4-hydroxyphenylboronic acid?
The European Community (EC) number is 829-441-4.
How many hydrogen bond donor counts does 2,5-Difluoro-4-hydroxyphenylboronic acid have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,5-Difluoro-4-hydroxyphenylboronic acid have?
It has 5 hydrogen bond acceptor counts.
Recommended Products
