What is the molecular formula of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The molecular formula is C8H8BClO4.
What is the molecular weight of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The molecular weight is 214.41 g/mol.
What is the IUPAC name of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The IUPAC name is (2-chloro-4-methoxycarbonylphenyl)boronic acid.
What is the InChI of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The InChI is InChI=1S/C8H8BClO4/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,12-13H,1H3.
What is the InChIKey of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The InChIKey is ITEQHBSWRMYSRP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The canonical SMILES is B(C1=C(C=C(C=C1)C(=O)OC)Cl)(O)O.
What is the CAS number of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The CAS number is 603122-80-1.
What is the European Community (EC) number of 2-Chloro-4-(methoxycarbonyl)phenylboronic acid?
The European Community (EC) number is 689-881-6.
Is 2-Chloro-4-(methoxycarbonyl)phenylboronic acid a covalently-bonded unit?
Yes, it is a covalently-bonded unit with a count of 1.