2,3-dichloro-5-(methylthio)pyrazine

• CAS: 1174517-48-6
• Catalog Number: ACM1174517486
• Category: Pyrazines
• Molecular Weight: 195.1
• Molecular Formula: C5H4Cl2N2S
• Appearance: Off-white Powder

Custom Q&A

What is the molecular formula of 2,3-dichloro-5-(methylthio)pyrazine?

The molecular formula of 2,3-dichloro-5-(methylthio)pyrazine is C5H4Cl2N2S.

What is the PubChem CID of 2,3-dichloro-5-(methylthio)pyrazine?

The PubChem CID of 2,3-dichloro-5-(methylthio)pyrazine is 91663899.

What is the IUPAC Name of 2,3-dichloro-5-(methylthio)pyrazine?

The IUPAC Name of 2,3-dichloro-5-(methylthio)pyrazine is 2,3-dichloro-5-methylsulfanylpyrazine.

What is the InChI of 2,3-dichloro-5-(methylthio)pyrazine?

The InChI of 2,3-dichloro-5-(methylthio)pyrazine is InChI=1S/C5H4Cl2N2S/c1-10-3-2-8-4(6)5(7)9-3/h2H,1H3.

What is the InChIKey of 2,3-dichloro-5-(methylthio)pyrazine?

The InChIKey of 2,3-dichloro-5-(methylthio)pyrazine is QZXHEYFNVBYHRD-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,3-dichloro-5-(methylthio)pyrazine?

The Canonical SMILES of 2,3-dichloro-5-(methylthio)pyrazine is CSC1=CN=C(C(=N1)Cl)Cl.

What is the molecular weight of 2,3-dichloro-5-(methylthio)pyrazine?

The molecular weight of 2,3-dichloro-5-(methylthio)pyrazine is 195.07 g/mol.

What is the XLogP3-AA value of 2,3-dichloro-5-(methylthio)pyrazine?

The XLogP3-AA value of 2,3-dichloro-5-(methylthio)pyrazine is 2.5.

How many hydrogen bond donor counts does 2,3-dichloro-5-(methylthio)pyrazine have?

2,3-dichloro-5-(methylthio)pyrazine has 0 hydrogen bond donor counts.

What is the topological polar surface area of 2,3-dichloro-5-(methylthio)pyrazine?

The topological polar surface area of 2,3-dichloro-5-(methylthio)pyrazine is 51.1 ?2.