1174517-48-6 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-cyclopropyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
The molecular formula of the compound is C9H13N3.
The molecular weight of the compound is 163.22 g/mol.
The InChI of the compound is InChI=1S/C9H13N3/c1-2-7(1)8-6-12-4-3-10-5-9(12)11-8/h6-7,10H,1-5H2.
The InChIKey of the compound is KUKPJVQJOWVXQW-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CC1C2=CN3CCNCC3=N2.
The XLogP3-AA value of the compound is -0.3.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 29.8 ?2.