3,6-dibromopyrazine-2-carbaldehyde

• CAS: 1270497-54-5
• Catalog Number: ACM1270497545
• Category: Pyrazines
• Molecular Weight: 265.9
• Molecular Formula: C5H2Br2N2O
• Appearance: Light Yellow Powder

Custom Q&A

What is the molecular formula of 3,6-dibromopyrazine-2-carbaldehyde?

The molecular formula is C5H2Br2N2O.

When was 3,6-dibromopyrazine-2-carbaldehyde created and modified?

It was created on 2012-08-19 and modified on 2023-12-30.

What is the IUPAC name of 3,6-dibromopyrazine-2-carbaldehyde?

The IUPAC name is 3,6-dibromopyrazine-2-carbaldehyde.

What is the InChI of 3,6-dibromopyrazine-2-carbaldehyde?

The InChI is InChI=1S/C5H2Br2N2O/c6-4-1-8-5(7)3(2-10)9-4/h1-2H.

What is the InChIKey of 3,6-dibromopyrazine-2-carbaldehyde?

The InChIKey is AQLHAAMPLQHZRM-UHFFFAOYSA-N.

What is the Canonical SMILES of 3,6-dibromopyrazine-2-carbaldehyde?

The Canonical SMILES is C1=C(N=C(C(=N1)Br)C=O)Br.

What is the molecular weight of 3,6-dibromopyrazine-2-carbaldehyde?

The molecular weight is 265.89 g/mol.

How many hydrogen bond acceptor counts does 3,6-dibromopyrazine-2-carbaldehyde have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 3,6-dibromopyrazine-2-carbaldehyde?

The topological polar surface area is 42.8A².

Is 3,6-dibromopyrazine-2-carbaldehyde considered canonicalized in PubChem?

Yes, the compound is considered canonicalized in PubChem.