CAS
--- Purity
---
--- Purity
---
Inquiry Basket
1-Methyl-prop-2-ynylamine
Catalog Number
ACMA00001279
Category
Amines
Molecular Weight
69.11
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H226-H301 + H331-H314-H351-H411
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the molecular formula of the compound?
The molecular formula of the compound is C4H7N.
What is the molecular weight of the compound?
The molecular weight of the compound is 69.11 g/mol.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is but-3-yn-2-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C4H7N/c1-3-4(2)5/h1,4H,5H2,2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is ZZRMYOZQUCUWFT-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC(C#C)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -0.2.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 1 hydrogen bond acceptor count.
How many rotatable bond counts does the compound have?
The compound has 0 rotatable bond count.
Recommended Products
