--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H6N4S.
The molecular weight of the compound is 166.21 g/mol.
The IUPAC name of the compound is 1-methyl-7H-pyrazolo[3,4-d]pyrimidine-4-thione.
The InChI of the compound is InChI=1S/C6H6N4S/c1-10-5-4(2-9-10)6(11)8-3-7-5/h2-3H,1H3,(H,7,8,11).
The InChIKey of the compound is JFSLGAFJXFHPDH-UHFFFAOYSA-N.
The canonical SMILES of the compound is CN1C2=C(C=N1)C(=S)N=CN2.
The CAS number of the compound is 6014-06-8.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
Yes, the compound is canonicalized.