3-Amino-6-methyl-thiazolo[3,2-b][1,2,4]triazin-7-one

• Catalog Number: ACMA00001404
• Category: Amines
• Molecular Weight: 182.20
• Hazard Statements: H301-H311-H331-H373-H412
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C6H6N4OS.

What is the molecular weight of the compound?

The molecular weight is 182.21 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-amino-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one.

What is the InChI of the compound?

The InChI is InChI=1S/C6H6N4OS/c1-3-5(11)8-6-10(9-3)4(7)2-12-6/h2H,7H2,1H3.

What is the InChIKey of the compound?

The InChIKey is BCSQOCJZQYFKBZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1=NN2C(=CSC2=NC1=O)N.

What is the CAS number of the compound?

The CAS number is 16943-37-6.

What is the ChEMBL ID of the compound?

The ChEMBL ID is CHEMBL1559311.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID is DTXSID40349465.

Is the compound canonicalized?

Yes, the compound is canonicalized.